Introduction：Basic information about CAS 724450-23-1|4-Iodo-1H-indole-6-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Iodo-1H-indole-6-carboxylic acid |
|---|
| CAS Number | 724450-23-1 | Molecular Weight | 287.054 |
|---|
| Density | 2.1±0.1 g/cm3 | Boiling Point | 489.1±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6INO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 249.6±24.6 °C |
|---|
Names
| Name | 4-iodo-1H-indole-6-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.1±0.1 g/cm3 |
|---|
| Boiling Point | 489.1±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6INO2 |
|---|
| Molecular Weight | 287.054 |
|---|
| Flash Point | 249.6±24.6 °C |
|---|
| Exact Mass | 286.944305 |
|---|
| PSA | 53.09000 |
|---|
| LogP | 3.03 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.800 |
|---|
| InChIKey | ICDDFJQDRKTPFX-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(I)c2cc[nH]c2c1 |
|---|
Synonyms
| 4-Iodo-1H-indole-6-carboxylic acid |
| 1H-Indole-6-carboxylicacid,4-iodo |
| 1H-Indole-6-carboxylic acid, 4-iodo- |
| 4-Iodo-6-indole carboxylic acid |
