Introduction：Basic information about CAS 602-69-7|1-Anthraquinonecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Anthraquinonecarboxylic acid |
|---|
| CAS Number | 602-69-7 | Molecular Weight | 252.22200 |
|---|
| Density | 1.469g/cm3 | Boiling Point | 513ºC at 760 mmHg |
|---|
| Molecular Formula | C15H8O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 278.2ºC |
|---|
Names
| Name | Anthraquinone-1-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.469g/cm3 |
|---|
| Boiling Point | 513ºC at 760 mmHg |
|---|
| Molecular Formula | C15H8O4 |
|---|
| Molecular Weight | 252.22200 |
|---|
| Flash Point | 278.2ºC |
|---|
| Exact Mass | 252.04200 |
|---|
| PSA | 71.44000 |
|---|
| LogP | 2.16020 |
|---|
| Index of Refraction | 1.69 |
|---|
| InChIKey | POPBYCBXVLHSKO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cccc2c1C(=O)c1ccccc1C2=O |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 9,10-anthraquinone-1-carboxylic acid |
| 1-Anthraquinonecarboxylic acid |
| 9,10-Dioxo-9,10-dihydro-anthracen-1-carbonsaeure |
| 9,10-Dihydro-9,10-dioxo-1-anthracenecarboxylic acid |
| 9,10-dioxo-9,10-dihydro-anthracene-1-carboxylic acid |
| 9,10-dioxo-9,10-dihydro-1-anthracene carboxylic acid |
| anthraquinonecarboxylic acid |
