Introduction：Basic information about CAS 28143-80-8|Methanesulfonic acid,1,1,1-trifluoro-, 1,2-dimethyl-1-propen-1-yl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanesulfonic acid,1,1,1-trifluoro-, 1,2-dimethyl-1-propen-1-yl ester |
|---|
| CAS Number | 28143-80-8 | Molecular Weight | 218.19400 |
|---|
| Density | 1.325g/cm3 | Boiling Point | 205.4ºC at 760mmHg |
|---|
| Molecular Formula | C6H9F3O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 78.1ºC |
|---|
Names
| Name | 3-methylbut-2-en-2-yl trifluoromethanesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.325g/cm3 |
|---|
| Boiling Point | 205.4ºC at 760mmHg |
|---|
| Molecular Formula | C6H9F3O3S |
|---|
| Molecular Weight | 218.19400 |
|---|
| Flash Point | 78.1ºC |
|---|
| Exact Mass | 218.02200 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 3.24720 |
|---|
| Vapour Pressure | 0.358mmHg at 25°C |
|---|
| Index of Refraction | 1.403 |
|---|
| InChIKey | ZOTJNLNOJYKPOI-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)=C(C)OS(=O)(=O)C(F)(F)F |
|---|
Synonyms
| 1,2-dimethyl-1-propenyl trifluoromethanesulfonate |
| 3-Methyl-2-buten-2-yl-triflat |
