Introduction：Basic information about CAS 1917-44-8|1,3,5-Triazin-2(1H)-one, 4,6-diphenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3,5-Triazin-2(1H)-one, 4,6-diphenyl- |
|---|
| CAS Number | 1917-44-8 | Molecular Weight | 249.26700 |
|---|
| Density | 1.24g/cm3 | Boiling Point | 391.1ºC at 760mmHg |
|---|
| Molecular Formula | C15H11N3O | Melting Point | 293 °C |
|---|
| MSDS | / | Flash Point | 190.4ºC |
|---|
Names
| Name | 2,6-diphenyl-1H-1,3,5-triazin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.24g/cm3 |
|---|
| Boiling Point | 391.1ºC at 760mmHg |
|---|
| Melting Point | 293 °C |
|---|
| Molecular Formula | C15H11N3O |
|---|
| Molecular Weight | 249.26700 |
|---|
| Flash Point | 190.4ºC |
|---|
| Exact Mass | 249.09000 |
|---|
| PSA | 58.90000 |
|---|
| LogP | 2.91120 |
|---|
| Vapour Pressure | 2.52E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.662 |
|---|
| InChIKey | KODLDJGSBFMSDG-UHFFFAOYSA-N |
|---|
| SMILES | O=c1nc(-c2ccccc2)nc(-c2ccccc2)[nH]1 |
|---|
Synonyms
| 2,4-Diphenyl-6-hydroxy-1,3,5-triazine |
| 4,6-diphenyl-1H-[1,3,5]triazin-2-one |
| 6-Hydroxy-2.4-diphenyl-1.3.5-triazin |
| 2.6-Diphenyl-3.4-dihydro-1.3.5-triazinon-(4) |
| 2-Oxo-4,6-diphenyl-1,2-dihydro-1,3,5-triazin |
| 4.6-Diphenyl-1.3.5-triazinon-(2) |
| 4,6-diphenyl-[1,3,5]triazin-2-ol |
| 1,3,5-Triazin-2(1H)-one, 4,6-diphenyl- |
