Introduction：Basic information about CAS 4197-09-5|C.I. Acid Violet 6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | C.I. Acid Violet 6 |
|---|
| CAS Number | 4197-09-5 | Molecular Weight | 566.47200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C20H16N4Na2O9S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | acid violet 7 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C20H16N4Na2O9S2 |
|---|
| Molecular Weight | 566.47200 |
|---|
| Exact Mass | 566.01500 |
|---|
| PSA | 234.31000 |
|---|
| LogP | 4.99340 |
|---|
| Index of Refraction | 1.73 |
|---|
| InChIKey | BMCXYDZRKLKERB-UHFFFAOYSA-L |
|---|
| SMILES | CC(=O)Nc1ccc(N=Nc2c(S(=O)(=O)[O-])cc3cc(S(=O)(=O)[O-])cc(O)c3c2O)cc1.[Na+].[Na+] |
|---|
Safety Information
| WGK Germany | 2 |
|---|
| RTECS | QJ6000000 |
|---|
Synonyms
| lissamine red |
| erio floxine 6b |
| chromotrope 6b |
| kiton red 6b |
| azofuchsin 6b |
| fast fuchsin 6b |
