Introduction:Basic information about CAS 27460-85-1|N-Boc protected D-4-hydroxyphenylglycine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Boc protected D-4-hydroxyphenylglycine |
|---|
| CAS Number | 27460-85-1 | Molecular Weight | 267.278 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 463.1±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H17NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 233.9±27.3 °C |
|---|
Names
| Name | (2R)-2-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 463.1±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H17NO5 |
|---|
| Molecular Weight | 267.278 |
|---|
| Flash Point | 233.9±27.3 °C |
|---|
| Exact Mass | 267.110687 |
|---|
| PSA | 95.86000 |
|---|
| LogP | 2.01 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.555 |
|---|
| InChIKey | LRWJRIFKJPPAPM-SNVBAGLBSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)c1ccc(O)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2924199090 |
|---|
Customs
| HS Code | 2924199090 |
|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Boc-D-Phg(4-OH)-OH |
| (4-Hydroxyphenyl)({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid |
| Boc-D-Hpg-OH |
| N-(tert-butoxycarbonyl)-D-2-(p-hydroxyphenyl)glycine |
| (D)-2-(t-butoxycarbonylamino)-2-(4-hydroxyphenyl)acetic acid |
| N-(tert-butyloxycarbonyl)-D-(p-hydroxyphenyl)glycine |
| Boc-4-hydroxy-D-phenylglycine |
| (R)-N-(tert-butoxycarbonyl)-4-hydroxyphenylglycine |
| N-(tert-butyloxycarbonyl)-D-(4-hydroxyphenyl)glycine |
| (R)-[(tert-butoxycarbonyl)amino](4-hydroxyphenyl)acetic acid |
| Benzeneacetic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]-4-hydroxy- |
| [(tert-Butoxycarbonyl)amino](4-hydroxyphenyl)acetic acid |
| N-(tert-butoxycarbonyl)-D-(4-hydroxyphenyl)glycine |