Introduction：Basic information about CAS 210830-03-8|Fmoc-d-dap(dde)-oh, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-d-dap(dde)-oh |
|---|
| CAS Number | 210830-03-8 | Molecular Weight | 490.548 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 719.2±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C28H30N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 388.8±32.9 °C |
|---|
Names
| Name | (2R)-3-[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 719.2±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C28H30N2O6 |
|---|
| Molecular Weight | 490.548 |
|---|
| Flash Point | 388.8±32.9 °C |
|---|
| Exact Mass | 490.210388 |
|---|
| PSA | 121.80000 |
|---|
| LogP | 4.77 |
|---|
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | GIPBZQFNSMWQIL-JOCHJYFZSA-N |
|---|
| SMILES | CC(=NCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)C1=C(O)CC(C)(C)CC1=O |
|---|
| Storage condition | Store at 0°C |
|---|
Synonyms
| AmbotzFAA1476 |
| I04-1231 |
| D-Alanine, 3-[[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethyl]amino]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-((1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethyl)amino)propanoic acid |
| (2R)-3-{[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethyl]amino}-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid |
| 3-{[1-(4,4-Dimethyl-2,6-dioxocyclohexylidene)ethyl]amino}-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-alanine |
| N-Fmoc-[N'-1-(4,4-dimethyl-2,6-dioxocyclohex-1-ylidene)ethyl]-D-2,3-diaminopropionic acid |
