Introduction：Basic information about CAS 654670-89-0|Fmoc-dap(mtt)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-dap(mtt)-OH |
|---|
| CAS Number | 654670-89-0 | Molecular Weight | 582.688 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 774.3±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C38H34N2O4 | Melting Point | 130-133 °C |
|---|
| MSDS | / | Flash Point | 422.1±32.9 °C |
|---|
Names
| Name | Fmoc-(N-β-4-methyltrityl)-L-α,β-diaminopropionic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 774.3±60.0 °C at 760 mmHg |
|---|
| Melting Point | 130-133 °C |
|---|
| Molecular Formula | C38H34N2O4 |
|---|
| Molecular Weight | 582.688 |
|---|
| Flash Point | 422.1±32.9 °C |
|---|
| Exact Mass | 582.251831 |
|---|
| PSA | 87.66000 |
|---|
| LogP | 10.16 |
|---|
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | WDZDBCVDBMWMAM-DHUJRADRSA-N |
|---|
| SMILES | Cc1ccc(C(NCC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)(c2ccccc2)c2ccccc2)cc1 |
|---|
Synonyms
| Fmoc-Asn(Trt)-ol |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-{[(4-methylphenyl)(diphenyl)methyl]amino}-L-alanine |
| Fmoc-Dap(Mtt)-OH |
| L-Alanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-3-[[(4-methylphenyl)diphenylmethyl]amino]- |
