Introduction：Basic information about CAS 88075-18-7|4-[(Trimethylsilyl)ethynyl]phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[(Trimethylsilyl)ethynyl]phenol |
|---|
| CAS Number | 88075-18-7 | Molecular Weight | 190.314 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 251.7±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H14OSi | Melting Point | / |
|---|
| MSDS | / | Flash Point | 106.0±25.1 °C |
|---|
Names
| Name | 4-(2-trimethylsilylethynyl)phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 251.7±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H14OSi |
|---|
| Molecular Weight | 190.314 |
|---|
| Flash Point | 106.0±25.1 °C |
|---|
| Exact Mass | 190.081390 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 3.72 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.530 |
|---|
| InChIKey | GCOHQMFWLBOIHL-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](C)(C)C#Cc1ccc(O)cc1 |
|---|
Synonyms
| Phenol,4-[(trimethylsilyl)ethynyl] |
| 4-[2-(Trimethylsilyl)ethynyl]-phenol |
| 4-[(Trimethylsilyl)ethynyl]phenol |
| Phenol, 4-[2-(trimethylsilyl)ethynyl]- |
| 4-hydroxyphenyl,trimethylsilylacetilene |
| 4-<(trimethylsilyl)ethynyl>phenol |
| 4-TMSE-phenol |
| 2-(4-hydroxyphenyl)-1-trimethylsilylacetylene |
| (4-hydroxyphenyl)ethynyltrimethylsilane |
| 1-(4-hydroxyphenyl)-2-trimethylsilylacetylene |
