Introduction：Basic information about CAS 885521-14-2|3-Iodo-4-nitro-1H-indazole-6-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Iodo-4-nitro-1H-indazole-6-carboxylic acid |
|---|
| CAS Number | 885521-14-2 | Molecular Weight | 333.039 |
|---|
| Density | 2.4±0.1 g/cm3 | Boiling Point | 585.8±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H4IN3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 308.1±30.1 °C |
|---|
Names
| Name | 3-iodo-4-nitro-2H-indazole-6-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.4±0.1 g/cm3 |
|---|
| Boiling Point | 585.8±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H4IN3O4 |
|---|
| Molecular Weight | 333.039 |
|---|
| Flash Point | 308.1±30.1 °C |
|---|
| Exact Mass | 332.924652 |
|---|
| PSA | 111.80000 |
|---|
| LogP | 2.76 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.846 |
|---|
| InChIKey | WKDVSUTUYUODKD-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc([N+](=O)[O-])c2c(I)[nH]nc2c1 |
|---|
Synonyms
| 3-Iodo-4-nitro-6-(1H)indazole carboxylic acid |
| 1H-Indazole-6-carboxylic acid, 3-iodo-4-nitro- |
| 3-Iodo-4-nitro-1H-indazole-6-carboxylic acid |
