Introduction:Basic information about CAS 41994-44-9|5-Chloro-2-nitrobenzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Chloro-2-nitrobenzoyl chloride |
|---|
| CAS Number | 41994-44-9 | Molecular Weight | 220.01000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C7H3Cl2NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-Chloro-2-nitrobenzoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C7H3Cl2NO3 |
|---|
| Molecular Weight | 220.01000 |
|---|
| Exact Mass | 218.94900 |
|---|
| PSA | 62.89000 |
|---|
| LogP | 3.15040 |
|---|
| InChIKey | ZYUYCUXFKGUOSP-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1cc(Cl)ccc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 5-chloro-2-nitro-benzoyl chloride |
| 2-nitro-5-chlorobenzoic acid chloride |
| 5-Chlor-2-nitro-benzoylchlorid |
| 5-chloro-2-nitrobenzoic acid chloride |