Introduction:Basic information about CAS 102170-56-9|2-bromo-6-methyl-4-nitroaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-bromo-6-methyl-4-nitroaniline |
|---|
| CAS Number | 102170-56-9 | Molecular Weight | 231.04700 |
|---|
| Density | 1.698 g/cm3 | Boiling Point | 366ºC at 760 mmHg |
|---|
| Molecular Formula | C7H7BrN2O2 | Melting Point | 180-184ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 175.2ºC |
|---|
Names
| Name | 2-bromo-6-methyl-4-nitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.698 g/cm3 |
|---|
| Boiling Point | 366ºC at 760 mmHg |
|---|
| Melting Point | 180-184ºC |
|---|
| Molecular Formula | C7H7BrN2O2 |
|---|
| Molecular Weight | 231.04700 |
|---|
| Flash Point | 175.2ºC |
|---|
| Exact Mass | 229.96900 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 3.35230 |
|---|
| Vapour Pressure | 1.51E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.648 |
|---|
| InChIKey | DCNWQCOXGLGSRC-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc([N+](=O)[O-])cc(Br)c1N |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | S36/37 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2921430090 |
|---|
Customs
| HS Code | 2921430090 |
|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-bromo-6-methyl-4-nitro-aniline |
| 2-bromo-6-methyl-4-nitro-phenylamine |
| MFCD00053089 |
| m-Brom-m-nitro-o-toluidin |
| 2-Brom-6-methyl-4-nitro-anilin |
| 2-amino-3-bromo-5-nitrotoluene |
| 6-Brom-4-nitro-o-toluidin |
| 3-Brom-5-nitro-2-amino-toluol |
| Benzenamine,2-bromo-6-methyl-4-nitro |