Introduction:Basic information about CAS 171850-32-1|5,7-Dichloro-4-hydroxy-3-quinolinecarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,7-Dichloro-4-hydroxy-3-quinolinecarbonitrile |
|---|
| CAS Number | 171850-32-1 | Molecular Weight | 239.05800 |
|---|
| Density | 1.63g/cm3 | Boiling Point | 449.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H4Cl2N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 225.8ºC |
|---|
Names
| Name | 5,7-Dichloro-4-hydroxy-3-quinolinecarbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.63g/cm3 |
|---|
| Boiling Point | 449.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H4Cl2N2O |
|---|
| Molecular Weight | 239.05800 |
|---|
| Flash Point | 225.8ºC |
|---|
| Exact Mass | 237.97000 |
|---|
| PSA | 56.65000 |
|---|
| LogP | 2.70658 |
|---|
| Vapour Pressure | 1.04E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.719 |
|---|
| InChIKey | OPRYMYABGBZYSU-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1c[nH]c2cc(Cl)cc(Cl)c2c1=O |
|---|