Introduction:Basic information about CAS 112190-04-2|4,6-Dichloro-8-methyl-3-quinolinecarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,6-Dichloro-8-methyl-3-quinolinecarbonitrile |
|---|
| CAS Number | 112190-04-2 | Molecular Weight | 237.08500 |
|---|
| Density | 1.43g/cm3 | Boiling Point | 386.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H6Cl2N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 187.7ºC |
|---|
Names
| Name | 4,6-Dichloro-8-methyl-3-quinolinecarbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.43g/cm3 |
|---|
| Boiling Point | 386.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H6Cl2N2 |
|---|
| Molecular Weight | 237.08500 |
|---|
| Flash Point | 187.7ºC |
|---|
| Exact Mass | 235.99100 |
|---|
| PSA | 36.68000 |
|---|
| LogP | 3.72168 |
|---|
| Vapour Pressure | 3.47E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.658 |
|---|
| InChIKey | WNYKOYIGOYPSAD-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(Cl)cc2c(Cl)c(C#N)cnc12 |
|---|