Introduction：Basic information about CAS 214470-72-1|4-Chloro-7-(2-chloroethoxy)-6-methoxy-3-quinolinecarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-7-(2-chloroethoxy)-6-methoxy-3-quinolinecarbonitrile |
|---|
| CAS Number | 214470-72-1 | Molecular Weight | 297.13700 |
|---|
| Density | 1.412g/cm3 | Boiling Point | 457.259ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10Cl2N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 230.342ºC |
|---|
Names
| Name | 4-Chloro-7-(2-chloroethoxy)-6-methoxy-3-quinolinecarbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.412g/cm3 |
|---|
| Boiling Point | 457.259ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10Cl2N2O2 |
|---|
| Molecular Weight | 297.13700 |
|---|
| Flash Point | 230.342ºC |
|---|
| Exact Mass | 296.01200 |
|---|
| PSA | 55.14000 |
|---|
| LogP | 3.38608 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.618 |
|---|
| InChIKey | GAOYRWYHERKJQE-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc2c(Cl)c(C#N)cnc2cc1OCCCl |
|---|
