Introduction:Basic information about CAS 941487-89-4|6-Bromo-2-(3-nitrophenyl)imidazo[1,2-a]pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Bromo-2-(3-nitrophenyl)imidazo[1,2-a]pyridine |
|---|
| CAS Number | 941487-89-4 | Molecular Weight | 318.12600 |
|---|
| Density | 1.67 | Boiling Point | / |
|---|
| Molecular Formula | C13H8BrN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-Bromo-2-(3-nitrophenyl)imidazo[1,2-a]pyridine |
|---|
Chemical & Physical Properties
| Density | 1.67 |
|---|
| Molecular Formula | C13H8BrN3O2 |
|---|
| Molecular Weight | 318.12600 |
|---|
| Exact Mass | 316.98000 |
|---|
| PSA | 63.12000 |
|---|
| LogP | 4.19520 |
|---|
| Index of Refraction | 1.721 |
|---|
| InChIKey | FECITZPXKWPMKV-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cccc(-c2cn3cc(Br)ccc3n2)c1 |
|---|