Introduction：Basic information about CAS 892869-59-9|(2Z)-2-(Hydroxymethylene)-3-oxoolean-12-en-28-oic acid phenylmethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2Z)-2-(Hydroxymethylene)-3-oxoolean-12-en-28-oic acid phenylmethyl ester |
|---|
| CAS Number | 892869-59-9 | Molecular Weight | 572.81700 |
|---|
| Density | 1.13 g/cm3 | Boiling Point | 638.9ºC at 760 mmHg |
|---|
| Molecular Formula | C38H52O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 189.9ºC |
|---|
Names
| Name | Benzyl (2Z)-2-(hydroxymethylene)-3-oxoolean-12-en-28-oate |
|---|
Chemical & Physical Properties
| Density | 1.13 g/cm3 |
|---|
| Boiling Point | 638.9ºC at 760 mmHg |
|---|
| Molecular Formula | C38H52O4 |
|---|
| Molecular Weight | 572.81700 |
|---|
| Flash Point | 189.9ºC |
|---|
| Exact Mass | 572.38700 |
|---|
| PSA | 63.60000 |
|---|
| LogP | 9.15240 |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | LQBSYZNNVWOVJN-RWEWTDSWSA-N |
|---|
| SMILES | CC1(C)CCC2(C(=O)OCc3ccccc3)CCC3(C)C(=CCC4C5(C)CC(=CO)C(=O)C(C)(C)C5CCC43C)C2C1 |
|---|
