Introduction:Basic information about CAS 239463-72-0|3-{5-[(2R)-2-Aminopropyl]-7-cyano-2,3-dihydro-1H-indol-1-yl}propy l benzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-{5-[(2R)-2-Aminopropyl]-7-cyano-2,3-dihydro-1H-indol-1-yl}propy l benzoate |
|---|
| CAS Number | 239463-72-0 | Molecular Weight | 363.453 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 567.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H25N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 296.9±30.1 °C |
|---|
Names
| Name | 3-{5-[(2R)-2-Aminopropyl]-7-cyano-2,3-dihydro-1H-indol-1-yl}propy l benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 567.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H25N3O2 |
|---|
| Molecular Weight | 363.453 |
|---|
| Flash Point | 296.9±30.1 °C |
|---|
| Exact Mass | 363.194672 |
|---|
| PSA | 79.35000 |
|---|
| LogP | 3.50 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | SPIYQPPDQNLNDT-MRXNPFEDSA-N |
|---|
| SMILES | CC(N)Cc1cc(C#N)c2c(c1)CCN2CCCOC(=O)c1ccccc1 |
|---|
Safety Information
Synonyms
| phenyl 2-pyridylthio ketone |
| benzoic acid 2-pyridylthio ester |
| thiobenzoic acid S-pyridin-2-yl ester |
| S-2-pyridyl 4-thiobenzoate |
| S-(2-pyridyl) benzothioate |
| 1-(3-benzoyloxypropyl)-7-cyano-5-(2R-aminopropyl)-2,3-dihydroindole |
| benzoic acid 3-[5(R)-(2-amino-propyl)-7-cyano-2,3-dihydro-indol-1-yl]-propyl ester |
| 3-{7-cyano-5-[(2R)-2-aminopropyl]-2,3-dihydro-1H-indole-1-yl}propylbenzoate |
| S-(2-pyridinyl) benzenecarbothioate |
| (R)-3-[5-(2-aminopropyl)-7-cyano-2,3-dihydro-1H-indol-1-yl]propyl benzoate |
| S-2-pyridyl benzoylthioate |
| S-2-pyridyl benzenecarbothioate |
| 1H-Indole-7-carbonitrile, 5-[(2R)-2-aminopropyl]-1-[3-(benzoyloxy)propyl]-2,3-dihydro- |
| 3-{5-[(2R)-2-Aminopropyl]-7-cyano-2,3-dihydro-1H-indol-1-yl}propyl benzoate |