Introduction：Basic information about CAS 104023-75-8|2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylic acid |
|---|
| CAS Number | 104023-75-8 | Molecular Weight | 275.128 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 391.8±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H12Cl2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 190.7±27.9 °C |
|---|
Names
| Name | 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 391.8±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H12Cl2O3 |
|---|
| Molecular Weight | 275.128 |
|---|
| Flash Point | 190.7±27.9 °C |
|---|
| Exact Mass | 274.016357 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 2.43 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.590 |
|---|
| InChIKey | DQXVWYCZSNWWIU-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1ccc(C2(C(=O)O)CC2(Cl)Cl)cc1 |
|---|
Synonyms
| 1-(4'-ethoxyphenyl)-2,2-dichlorocyclopropane-1-carboxylic acid |
| 2,2-dichloro-1-(4'-ethoxyphenyl)cyclopropane-1-carboxylic acid |
| Cyclopropanecarboxylic acid, 2,2-dichloro-1-(4-ethoxyphenyl)- |
| 2,2-Dichloro-1-(4-ethoxyphenyl)cyclopropanecarboxylicacid |
| 2,2-Dichloro-1-(4-ethoxyphenyl)cyclopropanecarboxylic acid |
| Cyclopropanecarboxylicacid,2,2-dichloro-1-(4-ethoxyphenyl) |
| 1-(4-ethyoxyphenyl)-2,2-dichlorocyclopropane-1-carboxylic acid |
| 1-p-ethoxyphenyl-2,2-dichlorocyclopropane-1-carboxylic acid |
| (+/-)-1-(4-ethoxyphenyl)-2,2-dichlorocyclopropanecarboxylic acid |
| 2,2-Dichloro-1-(4'-ethoxyphenyl)cyclopropane-1-carboxylicacid |
