Introduction：Basic information about CAS 89115-20-8|4-[Bis(4-methoxyphenyl)amino]benzaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[Bis(4-methoxyphenyl)amino]benzaldehyde |
|---|
| CAS Number | 89115-20-8 | Molecular Weight | 333.380 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 505.4±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H19NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 259.4±28.7 °C |
|---|
Names
| Name | 4-(4-methoxy-N-(4-methoxyphenyl)anilino)benzaldehyde |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 505.4±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H19NO3 |
|---|
| Molecular Weight | 333.380 |
|---|
| Flash Point | 259.4±28.7 °C |
|---|
| Exact Mass | 333.136505 |
|---|
| PSA | 38.77000 |
|---|
| LogP | 3.41 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.634 |
|---|
| InChIKey | CTRXZOLNEVJBDX-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(N(c2ccc(C=O)cc2)c2ccc(OC)cc2)cc1 |
|---|
Synonyms
| 4-(di(4-methoxyphenyl)amino)benzaldehyde |
| Benzaldehyde, 4-[bis(4-methoxyphenyl)amino]- |
| 4-(N,N-bis(4-methoxyphenyl)amino)benzaldehyde |
| 4-(di-(4-methoxyphenyl)amine)benzaldehyde |
| Benzaldehyde,4-[bis(4-methoxyphenyl)amino] |
| 4-[Bis(4-methoxyphenyl)amino]benzaldehyde |
| WT889 |
| 4-(N,N-di(4-methoxyphenyl)amino)benzaldehyde |
