Introduction：Basic information about CAS 66478-66-8|3,4-Di(tert-butoxy)-3-cyclobutene-1,2-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4-Di(tert-butoxy)-3-cyclobutene-1,2-dione |
|---|
| CAS Number | 66478-66-8 | Molecular Weight | 226.26900 |
|---|
| Density | 1.08 | Boiling Point | 331ºC at 760 mmHg |
|---|
| Molecular Formula | C12H18O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 144.1ºC |
|---|
Names
| Name | 3,4-bis[(2-methylpropan-2-yl)oxy]cyclobut-3-ene-1,2-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.08 |
|---|
| Boiling Point | 331ºC at 760 mmHg |
|---|
| Molecular Formula | C12H18O4 |
|---|
| Molecular Weight | 226.26900 |
|---|
| Flash Point | 144.1ºC |
|---|
| Exact Mass | 226.12100 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 1.98000 |
|---|
| Index of Refraction | 1.475 |
|---|
| InChIKey | GFBOYCVDBGFJFT-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)Oc1c(OC(C)(C)C)c(=O)c1=O |
|---|
Synonyms
| 3,4-Di(tert-butoxy)-3-cyclobutene-1,2-dione |
| 3,4-Di-tert-butoxy-3-cyclobuten-1,2-dion |
| 2,3-(Di-tert-butoxy)cyclobutenedione |
| 3,4-di(tert-butoxy)cyclobut-3-ene-1,2-dione |
| 1.2.-Di-tert-butoxycyclobutenedione |
