Introduction：Basic information about CAS 81147-94-6|Benzenepropanoicacid,4-(2-oxiranylmethoxy)-,methylester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenepropanoicacid,4-(2-oxiranylmethoxy)-,methylester |
|---|
| CAS Number | 81147-94-6 | Molecular Weight | 236.264 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 347.5±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 152.8±21.0 °C |
|---|
Names
| Name | methyl 3-[4-(oxiran-2-ylmethoxy)phenyl]propanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 347.5±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16O4 |
|---|
| Molecular Weight | 236.264 |
|---|
| Flash Point | 152.8±21.0 °C |
|---|
| Exact Mass | 236.104858 |
|---|
| PSA | 48.06000 |
|---|
| LogP | 1.78 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.526 |
|---|
| InChIKey | BDCUIFGTTIEBLT-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)CCc1ccc(OCC2CO2)cc1 |
|---|
Synonyms
| methyl 3-[4-(2,3-epoxypropoxy)phenyl]propionate |
| Methyl 3-[4-(2-oxiranylmethoxy)phenyl]propanoate |
| (S)-methyl 3-[4-(2,3-epoxypropoxy)phenyl]propionate |
| Benzenepropanoic acid,4-(oxiranylmethoxy)-,methyl ester |
| methyl 3-(4-oxiranylmethoxyphenyl)propionate |
| 4-(oxiranylmethoxy)-benzenepropanoate methyl ester |
| Benzenepropanoic acid, 4-(oxiranylmethoxy)-, methyl ester |
| Benzenepropanoicacid,4-(2-oxiranylmethoxy)-,methylester |
