Introduction:Basic information about CAS 943519-37-7|Methyl 2,4-dihydroxy-5-isopropylbenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 2,4-dihydroxy-5-isopropylbenzoate |
|---|
| CAS Number | 943519-37-7 | Molecular Weight | 210.22600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H14O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | methyl 2,4-dihydroxy-5-propan-2-ylbenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H14O4 |
|---|
| Molecular Weight | 210.22600 |
|---|
| Exact Mass | 210.08900 |
|---|
| PSA | 66.76000 |
|---|
| LogP | 2.00780 |
|---|
| InChIKey | NAOCXJWZGXUTCQ-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(C(C)C)c(O)cc1O |
|---|
Safety Information
Customs
| HS Code | 2918199090 |
|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 2,4-dihydroxy-5-isopropylbenzoic acid methyl ester |
| QC-4440 |
| methyl 2,4-dihydroxy-5-isopropylbenzoate |