Introduction:Basic information about CAS 1000343-72-5|4-Bromo-6-isopropyl-1H-indole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Bromo-6-isopropyl-1H-indole |
|---|
| CAS Number | 1000343-72-5 | Molecular Weight | 238.124 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 339.8±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H12BrN | Melting Point | / |
|---|
| MSDS | / | Flash Point | 159.3±22.3 °C |
|---|
Names
| Name | 4-bromo-6-propan-2-yl-1H-indole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 339.8±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H12BrN |
|---|
| Molecular Weight | 238.124 |
|---|
| Flash Point | 159.3±22.3 °C |
|---|
| Exact Mass | 237.015305 |
|---|
| PSA | 15.79000 |
|---|
| LogP | 4.25 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | LGQLORJHFRJVBT-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)c1cc(Br)c2cc[nH]c2c1 |
|---|
Synonyms
| 1H-Indole,4-broMo-6-(1-methyl ethyl) |
| 1H-Indole, 4-bromo-6-(1-methylethyl)- |
| 4-Bromo-6-isopropyl-1H-indole |
| 4-Bromo-6-isopropylindole |