Introduction：Basic information about CAS 885520-60-5|6-Methoxy-1H-indole-4-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Methoxy-1H-indole-4-carboxylic acid |
|---|
| CAS Number | 885520-60-5 | Molecular Weight | 191.183 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 447.6±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H9NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 224.5±23.2 °C |
|---|
Names
| Name | 6-Methoxy-1H-indole-4-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 447.6±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H9NO3 |
|---|
| Molecular Weight | 191.183 |
|---|
| Flash Point | 224.5±23.2 °C |
|---|
| Exact Mass | 191.058243 |
|---|
| PSA | 62.32000 |
|---|
| LogP | 1.88 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.677 |
|---|
| InChIKey | RUUYNZLHRCOJQI-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C(=O)O)c2cc[nH]c2c1 |
|---|
Synonyms
| 1H-Indole-4-carboxylic acid, 6-methoxy- |
| 6-Methoxy-1H-indole-4-carboxylic acid |
| 6-Methoxy-4-indolecarboxylic acid |
