Introduction:Basic information about CAS 28668-32-8|6-PHENYL-4-PYRIMIDINECARBOXYLIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-PHENYL-4-PYRIMIDINECARBOXYLIC ACID |
|---|
| CAS Number | 28668-32-8 | Molecular Weight | 200.19300 |
|---|
| Density | 1.302g/cm3 | Boiling Point | 440.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8N2O2 | Melting Point | 173-177ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 220.3ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 6-phenylpyrimidine-4-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.302g/cm3 |
|---|
| Boiling Point | 440.6ºC at 760 mmHg |
|---|
| Melting Point | 173-177ºC(lit.) |
|---|
| Molecular Formula | C11H8N2O2 |
|---|
| Molecular Weight | 200.19300 |
|---|
| Flash Point | 220.3ºC |
|---|
| Exact Mass | 200.05900 |
|---|
| PSA | 63.08000 |
|---|
| LogP | 1.84180 |
|---|
| Vapour Pressure | 1.54E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.619 |
|---|
| InChIKey | WPZVBDSJGHLIMS-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(-c2ccccc2)ncn1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | 22-36 |
|---|
| Safety Phrases | 26-37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-Phenyl-4-pyrimidinecarboxylic acid |
| MFCD06200701 |
| 6-Phenylpyrimidin-4-carbonsaeure |
| 6-Phenylpyrimidine-4-carboxylicacid |
| 4-Pyrimidinecarboxylicacid,6-phenyl |