Introduction:Basic information about CAS 2407-11-6|2-chloro-6-nitrobenzo[d]thiazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-chloro-6-nitrobenzo[d]thiazole |
|---|
| CAS Number | 2407-11-6 | Molecular Weight | 174.196 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 336.7±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H10O2 | Melting Point | 192-195ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 211.8±5.3 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-chloro-6-nitro-1,3-benzothiazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 336.7±15.0 °C at 760 mmHg |
|---|
| Melting Point | 192-195ºC |
|---|
| Molecular Formula | C11H10O2 |
|---|
| Molecular Weight | 174.196 |
|---|
| Flash Point | 211.8±5.3 °C |
|---|
| Exact Mass | 174.068085 |
|---|
| PSA | 86.95000 |
|---|
| LogP | 2.63 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.641 |
|---|
| InChIKey | KUCSJGBXJBQHNI-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc2nc(Cl)sc2c1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-chloro-6-nitro-benzthiazole |
| 6-Methoxy-naphthalen-2-ol |
| 6-nitro-2-chlorobenzothiazole |
| 2-chlor-6-nitrobenzo<d>thiazol |
| 6-Methoxynaphthalen-2-Ol |
| 2-Chloro-6-nitro-1,3-benzothiazole 6-Nitro-2-chlorobenzothiazole |
| 2-Naphthalenol, 6-methoxy- |
| 2-Chloro-6-nitrobenzothiazole |
| EINECS 219-302-0 |
| 6-Methoxy-2-naphthol |
| 2-Chloro-6-nitro-benzothiazole |
| 2-chloro-6-nitrobenzo[d]thiazole |
| MFCD00022852 |
| 2-Chloro-6-nitrolbenzothiazole |
| 2-Chlor-6-nitro-benzothiazol |