Introduction：Basic information about CAS 29548-86-5|2,5-Dibromohexanedioyl dichloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-Dibromohexanedioyl dichloride |
|---|
| CAS Number | 29548-86-5 | Molecular Weight | 340.82500 |
|---|
| Density | 1.985g/cm3 | Boiling Point | 312.263ºC at 760 mmHg |
|---|
| Molecular Formula | C6H6Br2Cl2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 142.652ºC |
|---|
Names
| Name | 2,5-Dibromohexanedioyl dichloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.985g/cm3 |
|---|
| Boiling Point | 312.263ºC at 760 mmHg |
|---|
| Molecular Formula | C6H6Br2Cl2O2 |
|---|
| Molecular Weight | 340.82500 |
|---|
| Flash Point | 142.652ºC |
|---|
| Exact Mass | 337.81100 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 2.82440 |
|---|
| Vapour Pressure | 0.001mmHg at 25°C |
|---|
| Index of Refraction | 1.553 |
|---|
| InChIKey | UMIRTQXSYVCPKO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)C(Br)CCC(Br)C(=O)Cl |
|---|
Synonyms
| 2,5-dibromoadipoly chloride |
| 2,5-Dibromoadipoyl Dichloride |
| Hexanedioic acid,2,5-dibromo |
| 2,5-dibromoadipoyl chloride |
| meso-2,5-Dibrom-adipinsaeure |
| 2,5-dibromoadipic acid |
| 2,5-dibromo-hexanedioyl dichloride |
