Introduction:Basic information about CAS 104459-82-7|[[[1-[5-[2-Chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-2-methoxyethylidene]ami, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [[[1-[5-[2-Chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-2-methoxyethylidene]amino]oxy]acetic acid methyl ester |
|---|
| CAS Number | 104459-82-7 | Molecular Weight | 476.78800 |
|---|
| Density | 1.41g/cm3 | Boiling Point | 490.7ºC at 760mmHg |
|---|
| Molecular Formula | C19H16ClF3N2O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 250.5ºC |
|---|
Names
| Name | fucaomi |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.41g/cm3 |
|---|
| Boiling Point | 490.7ºC at 760mmHg |
|---|
| Molecular Formula | C19H16ClF3N2O7 |
|---|
| Molecular Weight | 476.78800 |
|---|
| Flash Point | 250.5ºC |
|---|
| Exact Mass | 476.06000 |
|---|
| PSA | 112.17000 |
|---|
| LogP | 5.12260 |
|---|
| Vapour Pressure | 8.96E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.534 |
|---|
| InChIKey | GAIFAPDHLCPUMF-UHFFFAOYSA-N |
|---|
| SMILES | COCC(=NOCC(=O)OC)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
|---|
Synonyms
| methyl (EZ)-{1-[5-(2-chloro-α,α,α-trifluoro-p-tolyloxy)-2-nitrophenyl]-2-methoxyethylidene}aminooxyacetate |
| methyl 2-[[[1-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-2-methoxyethylidene]amino]oxy]acetate |
| methyl ({[(Ξ)-1-{5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl}-2-methoxyethylidene]amino}oxy)acetate |
| methyl 2-[(E)-[1-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-2-methoxyethylidene]amino]oxyacetate |