Introduction:Basic information about CAS 10448-09-6|2,2,4,4,6,6,8-heptamethyl-8-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2,4,4,6,6,8-heptamethyl-8-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|
| CAS Number | 10448-09-6 | Molecular Weight | 358.68500 |
|---|
| Density | 1.01g/cm3 | Boiling Point | 275.8ºC at 760mmHg |
|---|
| Molecular Formula | C13H26O4Si4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 107.4ºC |
|---|
Names
| Name | 2,2,4,4,6,6,8-heptamethyl-8-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.01g/cm3 |
|---|
| Boiling Point | 275.8ºC at 760mmHg |
|---|
| Molecular Formula | C13H26O4Si4 |
|---|
| Molecular Weight | 358.68500 |
|---|
| Flash Point | 107.4ºC |
|---|
| Exact Mass | 358.09100 |
|---|
| PSA | 36.92000 |
|---|
| LogP | 3.15100 |
|---|
| Vapour Pressure | 0.00837mmHg at 25°C |
|---|
| Index of Refraction | 1.472 |
|---|
| InChIKey | NSLNFHKUIKHPGY-UHFFFAOYSA-N |
|---|
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(c2ccccc2)O[Si](C)(C)O1 |
|---|
Safety Information
| RIDADR | UN 1993 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 3.2 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| phenylheptamethylcyclotetrasiloxane |
| 2.2.4.4.6.6.8-Heptamethyl-8-phenyl-cyclotetrasiloxan |
| Cyclic monophenylheptamethylcyclotetrasiloxane |
| HEPTAMETHYLPHENYLCYCLOTETRASILOXANE |
| Monophenylheptamethyl cyclotetrasiloxane |
| Cyclotetrasiloxane,heptamethylphenyl |
| Heptamethyl-phenyl-cyclotetrasiloxan |
| EINECS 233-931-8 |