Introduction：Basic information about CAS 2904-57-6|Benzonitrile,2,4,6-trimethyl-, N-oxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzonitrile,2,4,6-trimethyl-, N-oxide |
|---|
| CAS Number | 2904-57-6 | Molecular Weight | 161.20000 |
|---|
| Density | 0.98g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H11NO | Melting Point | 113-114ºC (methanol ) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2,4,6-trimethylbenzonitrile oxide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.98g/cm3 |
|---|
| Melting Point | 113-114ºC (methanol ) |
|---|
| Molecular Formula | C10H11NO |
|---|
| Molecular Weight | 161.20000 |
|---|
| Exact Mass | 161.08400 |
|---|
| PSA | 30.67000 |
|---|
| LogP | 2.51698 |
|---|
| Index of Refraction | 1.513 |
|---|
| InChIKey | ZILPALOUYKHPKI-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(C#[N+][O-])c(C)c1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H312-H319 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Risk Phrases | 20/21/22-36 |
|---|
| Safety Phrases | 26-36/37 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Mesitonitrile oxide |
| Benzonitrile,2,4,6-trimethyl-,N-oxide |
| Mesitylenenitrile oxide |
| mesityl nitrile oxide |
| Mesitonitrile N-oxide |
| 2,4,6-trimethylphenylnitrile oxide |
| 2,4,6-trimethylbenzonitrile-N-oxide |
