Introduction：Basic information about CAS 76811-98-8|Fexofenadinone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fexofenadinone |
|---|
| CAS Number | 76811-98-8 | Molecular Weight | 499.64000 |
|---|
| Density | 1.165 | Boiling Point | / |
|---|
| Molecular Formula | C32H37NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
Chemical & Physical Properties
| Density | 1.165 |
|---|
| Molecular Formula | C32H37NO4 |
|---|
| Molecular Weight | 499.64000 |
|---|
| Exact Mass | 499.27200 |
|---|
| PSA | 77.84000 |
|---|
| LogP | 5.59770 |
|---|
| InChIKey | NGAKDIWPTMPPFP-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C(=O)O)c1ccc(C(=O)CCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| RIDADR | NONH for all modes of transport |
|---|
