Introduction：Basic information about CAS 5006-44-0|6-methylchromone-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-methylchromone-2-carboxylic acid |
|---|
| CAS Number | 5006-44-0 | Molecular Weight | 204.17900 |
|---|
| Density | 1.421g/cm3 | Boiling Point | 367.2ºC at 760mmHg |
|---|
| Molecular Formula | C11H8O4 | Melting Point | 267-270 °C(lit.) |
|---|
| MSDS | / | Flash Point | 148.4ºC |
|---|
Names
| Name | 6-methylchromone-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.421g/cm3 |
|---|
| Boiling Point | 367.2ºC at 760mmHg |
|---|
| Melting Point | 267-270 °C(lit.) |
|---|
| Molecular Formula | C11H8O4 |
|---|
| Molecular Weight | 204.17900 |
|---|
| Flash Point | 148.4ºC |
|---|
| Exact Mass | 204.04200 |
|---|
| PSA | 67.51000 |
|---|
| LogP | 1.79960 |
|---|
| InChIKey | RKIDLZFIIVDZNX-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc2oc(C(=O)O)cc(=O)c2c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 6-METHYL-4-OXO-4H-CHROMENE-2-CARBOXYLIC ACID |
| 6-methyl-2-chromonecarboxylic acid |
| MFCD00239435 |
| 6-Methyl-4-oxo-4H-chromen-2-carbonsaeure |
| 6-Methyl-4-oxo-4H-1-benzopyran-2-carboxylic acid |
| 6-Methylchromone-2-carboxylic acid |
