Introduction：Basic information about CAS 17716-89-1|3-(2,5-dimethylpyrrolidin-1-yl)propyl 2-hydroxybenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(2,5-dimethylpyrrolidin-1-yl)propyl 2-hydroxybenzoate |
|---|
| CAS Number | 17716-89-1 | Molecular Weight | 277.35900 |
|---|
| Density | 1.089g/cm3 | Boiling Point | 385.3ºC at 760mmHg |
|---|
| Molecular Formula | C16H23NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 186.8ºC |
|---|
Names
| Name | 3-(2,5-dimethylpyrrolidin-1-yl)propyl 2-hydroxybenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.089g/cm3 |
|---|
| Boiling Point | 385.3ºC at 760mmHg |
|---|
| Molecular Formula | C16H23NO3 |
|---|
| Molecular Weight | 277.35900 |
|---|
| Flash Point | 186.8ºC |
|---|
| Exact Mass | 277.16800 |
|---|
| PSA | 49.77000 |
|---|
| LogP | 2.74980 |
|---|
| Vapour Pressure | 1.73E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.529 |
|---|
| InChIKey | TVNKQHWRADJSQD-UHFFFAOYSA-N |
|---|
| SMILES | CC1CCC(C)N1CCCOC(=O)c1ccccc1O |
|---|
Synonyms
| Pranosalum |
| UNII-4JB9426X1H |
| Pranosal |
