Introduction:Basic information about CAS 72066-77-4|methyl 4-[[[3-[[2-hydroxy-3-[[(2-methoxyphenyl)amino]carbonyl]-1-naphthyl]azo]-4-meth, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 4-[[[3-[[2-hydroxy-3-[[(2-methoxyphenyl)amino]carbonyl]-1-naphthyl]azo]-4-methylphenyl]sulphonyl]oxy]benzoate |
|---|
| CAS Number | 72066-77-4 | Molecular Weight | 625.64800 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 789.7ºC at 760 mmHg |
|---|
| Molecular Formula | C33H27N3O8S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 431.4ºC |
|---|
Names
| Name | methyl 4-[3-[(2Z)-2-[3-[(2-methoxyphenyl)carbamoyl]-2-oxonaphthalen-1-ylidene]hydrazinyl]-4-methylphenyl]sulfonyloxybenzoate |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 789.7ºC at 760 mmHg |
|---|
| Molecular Formula | C33H27N3O8S |
|---|
| Molecular Weight | 625.64800 |
|---|
| Flash Point | 431.4ºC |
|---|
| Exact Mass | 625.15200 |
|---|
| PSA | 161.33000 |
|---|
| LogP | 6.78220 |
|---|
| Index of Refraction | 1.64 |
|---|
| InChIKey | JZUDMLNXWNHULI-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(OS(=O)(=O)c2ccc(C)c(N=Nc3c(O)c(C(=O)Nc4ccccc4OC)cc4ccccc34)c2)cc1 |
|---|