Introduction：Basic information about CAS 74129-03-6|Teboquine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Teboquine |
|---|
| CAS Number | 74129-03-6 | Molecular Weight | 466.40200 |
|---|
| Density | 1.289g/cm3 | Boiling Point | 573.5ºC at 760 mmHg |
|---|
| Molecular Formula | C26H25Cl2N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 300.7ºC |
|---|
Names
| Name | 2-[(tert-butylamino)methyl]-6-(4-chlorophenyl)-4-[(7-chloroquinolin-4-yl)amino]phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.289g/cm3 |
|---|
| Boiling Point | 573.5ºC at 760 mmHg |
|---|
| Molecular Formula | C26H25Cl2N3O |
|---|
| Molecular Weight | 466.40200 |
|---|
| Flash Point | 300.7ºC |
|---|
| Exact Mass | 465.13700 |
|---|
| PSA | 57.18000 |
|---|
| LogP | 8.00980 |
|---|
| Index of Refraction | 1.668 |
|---|
| InChIKey | BCHMRNALCJISMZ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)NCc1cc(Nc2ccnc3cc(Cl)ccc23)cc(-c2ccc(Cl)cc2)c1O |
|---|
Synonyms
| Tebuquine |
| Tebuquinum |
| UNII-699Q1XT4EN |
| Tebuquina |
