Introduction：Basic information about CAS 520-40-1|humulinic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | humulinic acid |
|---|
| CAS Number | 520-40-1 | Molecular Weight | 266.33300 |
|---|
| Density | 1.211g/cm3 | Boiling Point | 425.7ºC at 760mmHg |
|---|
| Molecular Formula | C15H22O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 225.4ºC |
|---|
Names
| Name | 3-methyl-1-[2,3,5-trihydroxy-4-(3-methylbut-2-enyl)cyclopenta-1,4-dien-1-yl]butan-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.211g/cm3 |
|---|
| Boiling Point | 425.7ºC at 760mmHg |
|---|
| Molecular Formula | C15H22O4 |
|---|
| Molecular Weight | 266.33300 |
|---|
| Flash Point | 225.4ºC |
|---|
| Exact Mass | 266.15200 |
|---|
| PSA | 77.76000 |
|---|
| LogP | 2.95660 |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | VRBDOLKCKSULIG-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)=CCC1=C(O)C(C(=O)CC(C)C)=C(O)C1O |
|---|
Synonyms
| 1-Butanone,3-methyl-1-[2,3,5-trihydroxy-4-(3-methyl-2-butenyl)-1,4-cyclopentadien-1-yl] |
| Humulinic acid |
| 3-methyl-1-[2,3,5-trihydroxy-4-(3-methylbut-2-en-1-yl)cyclopenta-1,4-dien-1-yl]butan-1-one |
