Introduction:Basic information about CAS 56358-42-0|N,N'-naphthalene-1,5-diylbis[4-[(3-chloro-2-methylphenyl)azo]-3-hydroxynaphthalen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N'-naphthalene-1,5-diylbis[4-[(3-chloro-2-methylphenyl)azo]-3-hydroxynaphthalene-2-carboxamide] |
|---|
| CAS Number | 56358-42-0 | Molecular Weight | 803.69000 |
|---|
| Density | 1.39g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C46H32Cl2N6O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (4Z)-4-[(3-chloro-2-methylphenyl)hydrazinylidene]-N-[5-[[(4E)-4-[(3-chloro-2-methylphenyl)hydrazinylidene]-3-oxonaphthalene-2-carbonyl]amino]naphthalen-1-yl]-3-oxonaphthalene-2-carboxamide |
|---|
Chemical & Physical Properties
| Density | 1.39g/cm3 |
|---|
| Molecular Formula | C46H32Cl2N6O4 |
|---|
| Molecular Weight | 803.69000 |
|---|
| Exact Mass | 802.18600 |
|---|
| PSA | 148.10000 |
|---|
| LogP | 11.05040 |
|---|
| Index of Refraction | 1.707 |
|---|
| InChIKey | CDUQTTHCTBEGKX-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(Cl)cccc1N=Nc1c(O)c(C(=O)Nc2cccc3c(NC(=O)c4cc5ccccc5c(N=Nc5cccc(Cl)c5C)c4O)cccc23)cc2ccccc12 |
|---|