Introduction：Basic information about CAS 60421-20-7|H-Aib-OBzl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | H-Aib-OBzl |
|---|
| CAS Number | 60421-20-7 | Molecular Weight | 229.70300 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H16ClNO2 | Melting Point | 170-171℃ |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
Names
| Name | benzyl 2-amino-2-methylpropanoate,hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 170-171℃ |
|---|
| Molecular Formula | C11H16ClNO2 |
|---|
| Molecular Weight | 229.70300 |
|---|
| Exact Mass | 229.08700 |
|---|
| PSA | 52.32000 |
|---|
| LogP | 2.96940 |
|---|
| InChIKey | OXUUEIDXKLFLER-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(N)C(=O)OCc1ccccc1.Cl |
|---|
| Storage condition | 2-8°C |
|---|
| Water Solubility | H2O: soluble50mg/mL, clear, colorless |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| benzyl-2-amino-2-methylpropanoate hydrochloride salt |
| 2-aminoisobutyrate benzyl ester hydrochloride |
| Benzyl |A-aminoisobutyrate hydrochloride |
| Benzyl 2-amino-2-methylpropionate hydrochloride |
| benzyl 2-aminoisobutyryl hydrochloride |
| benzyl 2-amino-2-methylpropanoate hydrochloride |
| H-Aib-OBzl |
| 2-Methylalanine benzyl ester hydrochloride |
| H-Aib-OBn*HCl |
| 2-amino-2-methyl-propionic acid benzyl ester hydrochloride |
