Introduction：Basic information about CAS 62080-78-8|3,4-bis(4-hydroxyphenyl)-2,4-hexadienol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4-bis(4-hydroxyphenyl)-2,4-hexadienol |
|---|
| CAS Number | 62080-78-8 | Molecular Weight | 282.33400 |
|---|
| Density | 1.209g/cm3 | Boiling Point | 472.5ºC at 760 mmHg |
|---|
| Molecular Formula | C18H18O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 222.7ºC |
|---|
Names
| Name | 4-[6-hydroxy-4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.209g/cm3 |
|---|
| Boiling Point | 472.5ºC at 760 mmHg |
|---|
| Molecular Formula | C18H18O3 |
|---|
| Molecular Weight | 282.33400 |
|---|
| Flash Point | 222.7ºC |
|---|
| Exact Mass | 282.12600 |
|---|
| PSA | 60.69000 |
|---|
| LogP | 3.57700 |
|---|
| Index of Refraction | 1.647 |
|---|
| InChIKey | SHMXXVPNYYAZSZ-GACGMVTDSA-N |
|---|
| SMILES | CC=C(C(=CCO)c1ccc(O)cc1)c1ccc(O)cc1 |
|---|
Synonyms
| 3,4-Bis(4-hydroxyphenyl)-2,4-hexadienol |
| w-Hydroxydienestrol |
| Phenol,4,4'-[1-ethylidene-2-(2-hydroxyethylidene)-1,2-ethanediyl]bis-(9CI) |
