Introduction：Basic information about CAS 62243-72-5|2-[4-(Trifluoromethyl)phenyl]morpholine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[4-(Trifluoromethyl)phenyl]morpholine |
|---|
| CAS Number | 62243-72-5 | Molecular Weight | 231.214 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 291.9±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H12F3NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 130.3±25.9 °C |
|---|
Names
| Name | 2-[4-(trifluoromethyl)phenyl]morpholine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 291.9±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H12F3NO |
|---|
| Molecular Weight | 231.214 |
|---|
| Flash Point | 130.3±25.9 °C |
|---|
| Exact Mass | 231.087097 |
|---|
| PSA | 21.26000 |
|---|
| LogP | 1.61 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.465 |
|---|
| InChIKey | OMFWOWNSVWSVBC-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1ccc(C2CNCCO2)cc1 |
|---|
Synonyms
| QC-3486 |
| 2-[4-(Trifluoromethyl)phenyl]morpholine |
| 2-[4-(Trifluoromethyl)phenyl]-morpholine HCl |
| Morpholine, 2-[4-(trifluoromethyl)phenyl]- |
| 2-(4-(trifluoromethyl)phenyl)morpholine |
