Introduction：Basic information about CAS 2280-89-9|3-amino-2,4,6-triiodo-5-[(methylamino)carbonyl]benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-amino-2,4,6-triiodo-5-[(methylamino)carbonyl]benzoic acid |
|---|
| CAS Number | 2280-89-9 | Molecular Weight | 571.87700 |
|---|
| Density | 2.712g/cm3 | Boiling Point | 454ºC at 760mmHg |
|---|
| Molecular Formula | C9H7I3N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 228.4ºC |
|---|
Names
| Name | 3-amino-2,4,6-triiodo-5-(methylcarbamoyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.712g/cm3 |
|---|
| Boiling Point | 454ºC at 760mmHg |
|---|
| Molecular Formula | C9H7I3N2O3 |
|---|
| Molecular Weight | 571.87700 |
|---|
| Flash Point | 228.4ºC |
|---|
| Exact Mass | 571.75900 |
|---|
| PSA | 95.91000 |
|---|
| LogP | 3.29640 |
|---|
| Vapour Pressure | 4.92E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.795 |
|---|
| InChIKey | AKXKBAWZIVNNJR-UHFFFAOYSA-N |
|---|
| SMILES | CNC(=O)c1c(I)c(N)c(I)c(C(=O)O)c1I |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2,4,6-triiodo-5-amino-N-methylisophthalamic acid |
| 5-amino-3-methylcarbamoyl-2,4,6-triiodobenzoic acid |
| 3-amino-5-N-methylcarbamyl-2,4,6-triiodobenzoic acid |
| 5-amino-2,4,6-triiodo-N-methylisophthalamic acid |
| 5-AMINO-3-CARBOXY-2,4,6-TRIIODO-N-METHYL-BENZAMIDE |
| 2,4,6-triiodo-5-amino-isophthalic-acid-monomethylamide |
| EINECS 218-917-1 |
| 3-Amino-2,4,6-triiodo-5-(methylcarbamoyl)benzoic acid |
