Introduction:Basic information about CAS 2781-00-2|di-tert-butyl alpha,alpha,alpha',alpha'-tetramethyl-(p-phenylenedimethylene) d, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | di-tert-butyl alpha,alpha,alpha',alpha'-tetramethyl-(p-phenylenedimethylene) diperoxide |
|---|
| CAS Number | 2781-00-2 | Molecular Weight | 338.48200 |
|---|
| Density | 0.974g/cm3 | Boiling Point | 374.8ºC at 760mmHg |
|---|
| Molecular Formula | C20H34O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 137.3ºC |
|---|
Names
| Name | 1,4-bis(2-tert-butylperoxypropan-2-yl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.974g/cm3 |
|---|
| Boiling Point | 374.8ºC at 760mmHg |
|---|
| Molecular Formula | C20H34O4 |
|---|
| Molecular Weight | 338.48200 |
|---|
| Flash Point | 137.3ºC |
|---|
| Exact Mass | 338.24600 |
|---|
| PSA | 36.92000 |
|---|
| LogP | 5.65020 |
|---|
| Index of Refraction | 1.474 |
|---|
| InChIKey | GWQOYRSARAWVTC-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OOC(C)(C)c1ccc(C(C)(C)OOC(C)(C)C)cc1 |
|---|
Safety Information
Customs
| HS Code | 2909600000 |
|---|
| Summary | 2909600000 alcohol peroxides, ether peroxides, ketone peroxides and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| Peroximon F 100 |
| EINECS 220-479-1 |
| 1,4-Bis(2-tert-butylperoxiisopropyl)benzol |
| Perkadox U 14/40 |
| Perkadox 14/40C |
| Peroximon F 40 |
| 1,4-bis(tert-butylperoxyisopropyl)benzene |
| Peroxide,(p-phenylenediisopropylidene)bis(tert-butyl |