Introduction:Basic information about CAS 28411-49-6|bis(prop-2-enyl) benzene-1,2-dicarboxylate,2-methylidenebutanoic acid,2-methylprop-2-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(prop-2-enyl) benzene-1,2-dicarboxylate,2-methylidenebutanoic acid,2-methylprop-2-enoic acid |
|---|
| CAS Number | 28411-49-6 | Molecular Weight | 432.46400 |
|---|
| Density | / | Boiling Point | 329.1ºC at 760mmHg |
|---|
| Molecular Formula | C23H28O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 164.8ºC |
|---|
Names
| Name | bis(prop-2-enyl) benzene-1,2-dicarboxylate,2-methylidenebutanoic acid,2-methylprop-2-enoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 329.1ºC at 760mmHg |
|---|
| Molecular Formula | C23H28O8 |
|---|
| Molecular Weight | 432.46400 |
|---|
| Flash Point | 164.8ºC |
|---|
| Exact Mass | 432.17800 |
|---|
| PSA | 127.20000 |
|---|
| LogP | 4.05650 |
|---|
| Vapour Pressure | 0.000182mmHg at 25°C |
|---|
| InChIKey | ASLHSTUXEMDXLG-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)C(=O)O.C=C(CC)C(=O)O.C=CCOC(=O)c1ccccc1C(=O)OCC=C |
|---|
Synonyms
| 1,2-Benzenedicarboxylic acid,di-2-propenyl ester,polymer with ethyl 2-propenoate and 2-methyl-2-propenoic acid |
| Phthalic acid,diallyl ester,polymer with ethyl acrylate and methacrylic acid |
| diallyl benzene-1,2-dicarboxylate |
| Ethyl acrylate,methacrylic acid,1,2-benzenedicarboxylic acid,di-2-propenyl ester polymer |