Introduction：Basic information about CAS 32856-94-3|5-(4-Hydroxy Phenyl) Hydantion, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(4-Hydroxy Phenyl) Hydantion |
|---|
| CAS Number | 32856-94-3 | Molecular Weight | 194.18700 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C9H10N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-(4-Hydroxy Phenyl) Hydantion |
|---|
Chemical & Physical Properties
| Molecular Formula | C9H10N2O3 |
|---|
| Molecular Weight | 194.18700 |
|---|
| Exact Mass | 194.06900 |
|---|
| PSA | 78.43000 |
|---|
| LogP | 1.17650 |
|---|
| InChIKey | HFKWGSAUBYZFSE-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CC(c2ccc(O)cc2)C(=O)N1 |
|---|
Safety Information
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
