Introduction：Basic information about CAS 28730-78-1|Dimethyl-4-bromisophthalat, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dimethyl-4-bromisophthalat |
|---|
| CAS Number | 28730-78-1 | Molecular Weight | 273.080 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 331.7±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H9BrO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 154.4±22.3 °C |
|---|
Names
| Name | methyl 2-bromo-5-methoxycarbonylbenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 331.7±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H9BrO4 |
|---|
| Molecular Weight | 273.080 |
|---|
| Flash Point | 154.4±22.3 °C |
|---|
| Exact Mass | 271.968414 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 2.78 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | ADXCABFZLVXCNW-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(Br)c(C(=O)OC)c1 |
|---|
Synonyms
| Dimethyl-4-bromisophthalat |
| 4-Bromoisophtalate de diméthyle |
| 4-bromo-1,3-benzenedicarboxylic acid dimethyl ester |
| dimethyl 4-bromo-isophthalate |
| 4-Bromo-isophthalic acid dimethyl ester |
| 1,3-Benzenedicarboxylic acid, 4-bromo-, dimethyl ester |
| 1,3-dicarbomethoxy-4-bromobenzene |
| 4-bromoisophthalic acid dimethyl ester |
| dimethyl 4-bromobenzene-1,3-dicarboxylate |
| Dimethyl 4-bromoisophthalate |
