Introduction：Basic information about CAS 880-68-2|1,4-Phenylenebis(phosphonic acid), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-Phenylenebis(phosphonic acid) |
|---|
| CAS Number | 880-68-2 | Molecular Weight | 238.072 |
|---|
| Density | 1.8±0.1 g/cm3 | Boiling Point | 580.4±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H8O6P2 | Melting Point | 288 °C |
|---|
| MSDS | / | Flash Point | 304.8±32.9 °C |
|---|
Names
| Name | (4-phosphonophenyl)phosphonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|
| Boiling Point | 580.4±60.0 °C at 760 mmHg |
|---|
| Melting Point | 288 °C |
|---|
| Molecular Formula | C6H8O6P2 |
|---|
| Molecular Weight | 238.072 |
|---|
| Flash Point | 304.8±32.9 °C |
|---|
| Exact Mass | 237.979614 |
|---|
| PSA | 134.68000 |
|---|
| LogP | -1.14 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.620 |
|---|
| InChIKey | JHDJUJAFXNIIIW-UHFFFAOYSA-N |
|---|
| SMILES | O=P(O)(O)c1ccc(P(=O)(O)O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 1,4-phenylenebisphosphonic acid |
| Phosphonic acid,p-phenylenedi |
| 4-phosphonophenylphosphonic acid |
| 1,4-phenyldiphosphonic acid |
| 1,4-Phenylenebis(phosphonic acid) |
| 1,4-Benzenebisphosphonic acid |
| Phenylene-1,4-diphosphonic acid |
| p-Phenylenediphosphonic acid |
| 1,4-benzenediphosphonic acid |
| 1,4-phenylenediphosphonic acid |
| Phosphonic acid, 1,4-phenylenebis- |
