Introduction:Basic information about CAS 108149-60-6|3-O-tert-butyl 4-O-methyl (4S)-2,2-dimethyl-1,3-oxazolidine-3,4-dicarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-O-tert-butyl 4-O-methyl (4S)-2,2-dimethyl-1,3-oxazolidine-3,4-dicarboxylate |
|---|
| CAS Number | 108149-60-6 | Molecular Weight | 259.299 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 309.7±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H21NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 141.1±27.9 °C |
|---|
Names
| Name | 3-O-tert-butyl 4-O-methyl (4S)-2,2-dimethyl-1,3-oxazolidine-3,4-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 309.7±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H21NO5 |
|---|
| Molecular Weight | 259.299 |
|---|
| Flash Point | 141.1±27.9 °C |
|---|
| Exact Mass | 259.141968 |
|---|
| PSA | 65.07000 |
|---|
| LogP | 1.49 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.460 |
|---|
| InChIKey | ZNBUXTFASGDVCL-QMMMGPOBSA-N |
|---|
| SMILES | COC(=O)C1COC(C)(C)N1C(=O)OC(C)(C)C |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Methyl (S)-(-)-3-tert-Butoxycarbonyl-2,2-dimethyl-4-oxazolidinecarboxylate |
| (S)-(-)-3-tert-Butoxycarbonyl-4-methoxycarbonyl-2,2-dimethyl-1,3-oxazolidine |
| 4-methyl (S)-2,2-dimethyl-3,4-oxazolidinedicarboxylate |
| N-tert-butoxycarbonyl 4(S)-(1'-methoxycarbonyl)-2,2-dimethyl-1,3-oxazolidine |
| Methyl (S)-(-)-3-Boc-2,2-dimethyl-4-oxazolidinecarboxylate |
| (S)-N-Boc-2,2-dimethyloxazolindine-4-carboxylic acid methyl ester |
| (S)-3-Boc-2,2-Dimethyl-oxazolidine-4-carboxylic acid methyl ester |
| 3-tert-Butyl 4-methyl (4S)-2,2-dimethyl-1,3-oxazolidine-3,4-dicarboxylate |
| Methyl(4S)-3-(tert-butoxycarbonyl)-2,2-dimethyloxazolidine-4-carboxylate |
| (S)-2,2-dimethyl-oxazolidine-3,4-dicarboxylic acid 3-tert-butyl ester 4-methyl ester |
| 2,2-dimethyloxazolidine-3,4-dicarboxylic acid 3-tert-butyl ester 4-methyl ester |
| (S)-(-)-3-Boc-4-methoxycarbonyl-2,2-dimethyl-1,3-oxazolidine |
| 4-Methyl 3-(2-methyl-2-propanyl) (4S)-2,2-dimethyl-1,3-oxazolidine-3,4-dicarboxylate |
| 3-(1,1-dimethylethyl) |
| Methyl (S)-(-)-3-(tert-butoxycarbonyl)-2,2-dimethyl-4-oxazolidinecarboxylate |
| Garner's ester |
| Methyl (S)-(-)3-BOC-2,2-dimethyl-4-oxazolidinecarboxylate |
| MFCD00192279 |
| 3,4-Oxazolidinedicarboxylic acid, 2,2-dimethyl-, 3-(1,1-dimethylethyl) 4-methyl ester, (4S)- |
| Methyl (4S)-3-tert-butoxycarbonyl-2,2-dimethyl-1,3-oxazolidine-4-carboxylate |