Introduction:Basic information about CAS 50887-69-9|2,6-Dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid hydrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-Dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid hydrate |
|---|
| CAS Number | 50887-69-9 | Molecular Weight | 174.111 |
|---|
| Density | 1.642 g/cm3 | Boiling Point | 656.9ºCat 760 mmHg |
|---|
| Molecular Formula | C5H6N2O5 | Melting Point | >300 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 351.1ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | Orotic Acid Monohydrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.642 g/cm3 |
|---|
| Boiling Point | 656.9ºCat 760 mmHg |
|---|
| Melting Point | >300 °C(lit.) |
|---|
| Molecular Formula | C5H6N2O5 |
|---|
| Molecular Weight | 174.111 |
|---|
| Flash Point | 351.1ºC |
|---|
| Exact Mass | 174.027664 |
|---|
| PSA | 112.25000 |
|---|
| InChIKey | YXUZGLGRBBHYFZ-UHFFFAOYSA-N |
|---|
| SMILES | O.O=C(O)c1cc(=O)[nH]c(=O)[nH]1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R22 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| RTECS | RM3180000 |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| MFCD00149398 |
| 6-Carboxyuracil Monohydrate |
| 4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, monohydrate |
| 2,6-Dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid hydrate (1:1) |
| Orotic acid hydrate |
| Vitamin B13 monohydrate |
| Orotic acid monohydrate |
| 4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, hydrate (1:1) |
| 2,6-Dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid hydrate |
| EINECS 200-619-8 |
| 2,6-Dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid |
| Uracil-6-carboxylic acid monohydrate |