Introduction：Basic information about CAS 22094-93-5|Pigment Yellow 81, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pigment Yellow 81 |
|---|
| CAS Number | 22094-93-5 | Molecular Weight | 657.54600 |
|---|
| Density | 1.38 | Boiling Point | 821ºC at 760mmHg |
|---|
| Molecular Formula | C34H30Cl2N6O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Pigment Yellow 81 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.38 |
|---|
| Boiling Point | 821ºC at 760mmHg |
|---|
| Molecular Formula | C34H30Cl2N6O4 |
|---|
| Molecular Weight | 657.54600 |
|---|
| Exact Mass | 656.17100 |
|---|
| PSA | 148.10000 |
|---|
| LogP | 10.44700 |
|---|
| Vapour Pressure | 4.62E-27mmHg at 25°C |
|---|
| Index of Refraction | 1.642 |
|---|
| InChIKey | GPWXTTPSHZOIKO-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)C(N=Nc1cc(Cl)c(-c2cc(Cl)c(N=NC(C(C)=O)C(=O)Nc3ccc(C)cc3C)cc2Cl)cc1Cl)C(=O)Nc1ccc(C)cc1C |
|---|
Synonyms
| 6128 Benzidine Yellow10G |
| PVYELLOWH108 |
| Lithol Fast Yellow 0991K |
| Benzidine Yellow 10G |
| Plasco yellow 81 |
| Einecs 244-776-0 |
| C.I. Pigment yellow 81 |
| Permanent Yellow H 10G |
